C15H21NO3 — CID 82122182
N-tert-butyl-2-(4-methoxy-2,5-dimethylphenyl)-2-oxoacetamide (PubChem CID 82122182) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-tert-butyl-2-(4-methoxy-2,5-dimethylphenyl)-2-oxoacetamide.
| Compound Name | N-tert-butyl-2-(4-methoxy-2,5-dimethylphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 82122182 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-tert-butyl-2-(4-methoxy-2,5-dimethylphenyl)-2-oxoacetamide |
| SMILES | COc1cc(C)c(C(=O)C(=O)NC(C)(C)C)cc1C |
| InChI | InChI=1S/C15H21NO3/c1-9-8-12(19-6)10(2)7-11(9)13(17)14(18)16-15(3,4)5/h7-8H,1-6H3,(H,16,18) |
| InChIKey | LSGBRBZTGLALFM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|