About 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol
3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol (PubChem CID 82125053) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol |
| PubChem CID | 82125053 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol |
| SMILES | CCc1nnc(CCCO)o1 |
| InChI | InChI=1S/C7H12N2O2/c1-2-6-8-9-7(11-6)4-3-5-10/h10H,2-5H2,1H3 |
| InChIKey | SKLIUWLBRGLFAS-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol?
The IUPAC name of 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol (CID 82125053) is 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol.
What is the SMILES notation for 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol?
The canonical SMILES for 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol is CCc1nnc(CCCO)o1.
What is the InChIKey of 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol?
The InChIKey is SKLIUWLBRGLFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-2-6-8-9-7(11-6)4-3-5-10/h10H,2-5H2,1H3.
What are the key properties of 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol?
3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol has a molecular weight of 156.18 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethyl-1,3,4-oxadiazol-2-yl)propan-1-ol is sourced from PubChem (CID 82125053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).