C13H21NO — CID 82126575
1-(3,4-dimethylphenoxy)-N,2-dimethylpropan-2-amine (PubChem CID 82126575) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 1-(3,4-dimethylphenoxy)-N,2-dimethylpropan-2-amine.
| Compound Name | 1-(3,4-dimethylphenoxy)-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 82126575 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 1-(3,4-dimethylphenoxy)-N,2-dimethylpropan-2-amine |
| SMILES | CNC(C)(C)COc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H21NO/c1-10-6-7-12(8-11(10)2)15-9-13(3,4)14-5/h6-8,14H,9H2,1-5H3 |
| InChIKey | URNOTSRKGWDNCK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |