C17H16N2O — CID 82133612
N-(cyanomethyl)-3,4-dimethyl-N-phenylbenzamide (PubChem CID 82133612) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is N-(cyanomethyl)-3,4-dimethyl-N-phenylbenzamide.
| Compound Name | N-(cyanomethyl)-3,4-dimethyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 82133612 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-(cyanomethyl)-3,4-dimethyl-N-phenylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CC#N)c2ccccc2)cc1C |
| InChI | InChI=1S/C17H16N2O/c1-13-8-9-15(12-14(13)2)17(20)19(11-10-18)16-6-4-3-5-7-16/h3-9,12H,11H2,1-2H3 |
| InChIKey | BTGXSDZSVXHEPH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|