C11H10N2O4S — CID 82133808
1-(1,3-benzodioxol-5-yl)-2-methylsulfonylimidazole (PubChem CID 82133808) has the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-methylsulfonylimidazole.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-methylsulfonylimidazole |
|---|---|
| PubChem CID | 82133808 |
| Molecular Formula | C11H10N2O4S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-methylsulfonylimidazole |
| SMILES | CS(=O)(=O)c1nccn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H10N2O4S/c1-18(14,15)11-12-4-5-13(11)8-2-3-9-10(6-8)17-7-16-9/h2-6H,7H2,1H3 |
| InChIKey | WFRDQHZFKIKABT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |