C12H11N3O3S — CID 94700017
2-[1-(1,3-benzodioxol-5-yl)imidazol-2-yl]sulfanylacetamide (PubChem CID 94700017) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-yl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | 2-[1-(1,3-benzodioxol-5-yl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 94700017 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-yl)imidazol-2-yl]sulfanylacetamide |
| SMILES | NC(=O)CSc1nccn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H11N3O3S/c13-11(16)6-19-12-14-3-4-15(12)8-1-2-9-10(5-8)18-7-17-9/h1-5H,6-7H2,(H2,13,16) |
| InChIKey | OJUSCWZKMKLNOB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |