C19H15FN4O4S — CID 9020928
N'-[2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 9020928) has the molecular formula C19H15FN4O4S and a molecular weight of 414.42 g/mol. Its IUPAC name is N'-[2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 9020928 |
| Molecular Formula | C19H15FN4O4S |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N'-[2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | O=C(CSc1nccn1-c1cccc(F)c1)NNC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H15FN4O4S/c20-13-2-1-3-14(9-13)24-7-6-21-19(24)29-10-17(25)22-23-18(26)12-4-5-15-16(8-12)28-11-27-15/h1-9H,10-11H2,(H,22,25)(H,23,26) |
| InChIKey | BGHWDRZIKVXWFP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|