C22H25FN4O2S — CID 30063411
N-(1-adamantylcarbamoyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide (PubChem CID 30063411) has the molecular formula C22H25FN4O2S and a molecular weight of 428.53 g/mol. Its IUPAC name is N-(1-adamantylcarbamoyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(1-adamantylcarbamoyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 30063411 |
| Molecular Formula | C22H25FN4O2S |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-(1-adamantylcarbamoyl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nccn1-c1cccc(F)c1)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H25FN4O2S/c23-17-2-1-3-18(9-17)27-5-4-24-21(27)30-13-19(28)25-20(29)26-22-10-14-6-15(11-22)8-16(7-14)12-22/h1-5,9,14-16H,6-8,10-13H2,(H2,25,26,28,29) |
| InChIKey | RILBRKASRWJEPJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |