C19H20FN5O3S — CID 8002445
N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide (PubChem CID 8002445) has the molecular formula C19H20FN5O3S and a molecular weight of 417.47 g/mol. Its IUPAC name is N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 8002445 |
| Molecular Formula | C19H20FN5O3S |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-2-[1-(3-fluorophenyl)imidazol-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nccn1-c1cccc(F)c1)NN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C19H20FN5O3S/c20-13-5-4-6-14(11-13)24-10-9-21-18(24)29-12-15(26)23-25-16(27)19(22-17(25)28)7-2-1-3-8-19/h4-6,9-11H,1-3,7-8,12H2,(H,22,28)(H,23,26) |
| InChIKey | LWVWKCADFOCWIB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|