C20H27NO — CID 82138257
5-(3,4-dimethylphenoxy)-2-methyl-2-phenylpentan-1-amine (PubChem CID 82138257) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is 5-(3,4-dimethylphenoxy)-2-methyl-2-phenylpentan-1-amine.
| Compound Name | 5-(3,4-dimethylphenoxy)-2-methyl-2-phenylpentan-1-amine |
|---|---|
| PubChem CID | 82138257 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 5-(3,4-dimethylphenoxy)-2-methyl-2-phenylpentan-1-amine |
| SMILES | Cc1ccc(OCCCC(C)(CN)c2ccccc2)cc1C |
| InChI | InChI=1S/C20H27NO/c1-16-10-11-19(14-17(16)2)22-13-7-12-20(3,15-21)18-8-5-4-6-9-18/h4-6,8-11,14H,7,12-13,15,21H2,1-3H3 |
| InChIKey | RCGBIRYBANRWGF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|