C17H20Cl2N2 — CID 82140058
3-[1-amino-3-(3,4-dichlorophenyl)propan-2-yl]-N,N-dimethylaniline (PubChem CID 82140058) has the molecular formula C17H20Cl2N2 and a molecular weight of 323.27 g/mol. Its IUPAC name is 3-[1-amino-3-(3,4-dichlorophenyl)propan-2-yl]-N,N-dimethylaniline.
| Compound Name | 3-[1-amino-3-(3,4-dichlorophenyl)propan-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 82140058 |
| Molecular Formula | C17H20Cl2N2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-[1-amino-3-(3,4-dichlorophenyl)propan-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C(CN)Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C17H20Cl2N2/c1-21(2)15-5-3-4-13(10-15)14(11-20)8-12-6-7-16(18)17(19)9-12/h3-7,9-10,14H,8,11,20H2,1-2H3 |
| InChIKey | GKIVYSZUVXYZIP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |