C17H17FN2O2 — CID 82143059
4-(1-aminopropan-2-yl)-6-fluoro-2-phenyl-1,4-benzoxazin-3-one (PubChem CID 82143059) has the molecular formula C17H17FN2O2 and a molecular weight of 300.33 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yl)-6-fluoro-2-phenyl-1,4-benzoxazin-3-one.
| Compound Name | 4-(1-aminopropan-2-yl)-6-fluoro-2-phenyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82143059 |
| Molecular Formula | C17H17FN2O2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-(1-aminopropan-2-yl)-6-fluoro-2-phenyl-1,4-benzoxazin-3-one |
| SMILES | CC(CN)N1C(=O)C(c2ccccc2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C17H17FN2O2/c1-11(10-19)20-14-9-13(18)7-8-15(14)22-16(17(20)21)12-5-3-2-4-6-12/h2-9,11,16H,10,19H2,1H3 |
| InChIKey | OWCYFKTXMMEZLN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |