About 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile
3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile (PubChem CID 82146302) has the molecular formula C19H15F2N3
and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile |
| PubChem CID | 82146302 |
| Molecular Formula | C19H15F2N3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile |
| SMILES | CC(C#N)Cn1c(/C=C/c2ccccc2)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C19H15F2N3/c1-13(11-22)12-24-18-10-16(21)15(20)9-17(18)23-19(24)8-7-14-5-3-2-4-6-14/h2-10,13H,12H2,1H3/b8-7+ |
| InChIKey | GBWUEJSBVLXANV-BQYQJAHWSA-N |
| XLogP | 4.64 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile?
The IUPAC name of 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile (CID 82146302) is 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile.
What is the SMILES notation for 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile?
The canonical SMILES for 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile is CC(C#N)Cn1c(/C=C/c2ccccc2)nc2cc(F)c(F)cc21.
What is the InChIKey of 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile?
The InChIKey is GBWUEJSBVLXANV-BQYQJAHWSA-N. The full InChI is InChI=1S/C19H15F2N3/c1-13(11-22)12-24-18-10-16(21)15(20)9-17(18)23-19(24)8-7-14-5-3-2-4-6-14/h2-10,13H,12H2,1H3/b8-7+.
What are the key properties of 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile?
3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile has a molecular weight of 323.35 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5,6-difluoro-2-[(E)-2-phenylethenyl]benzimidazol-1-yl]-2-methylpropanenitrile is sourced from PubChem (CID 82146302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).