C15H11N3O4 — CID 82146561
3-([1,3]dioxolo[4,5-f]benzotriazol-1-ylmethyl)benzoic acid (PubChem CID 82146561) has the molecular formula C15H11N3O4 and a molecular weight of 297.27 g/mol. Its IUPAC name is 3-([1,3]dioxolo[4,5-f]benzotriazol-1-ylmethyl)benzoic acid.
| Compound Name | 3-([1,3]dioxolo[4,5-f]benzotriazol-1-ylmethyl)benzoic acid |
|---|---|
| PubChem CID | 82146561 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-([1,3]dioxolo[4,5-f]benzotriazol-1-ylmethyl)benzoic acid |
| SMILES | O=C(O)c1cccc(Cn2nnc3cc4c(cc32)OCO4)c1 |
| InChI | InChI=1S/C15H11N3O4/c19-15(20)10-3-1-2-9(4-10)7-18-12-6-14-13(21-8-22-14)5-11(12)16-17-18/h1-6H,7-8H2,(H,19,20) |
| InChIKey | HMONEHCPMWPPRI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |