4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid

C14H9Cl2N3O2 — CID 94750680

IUPAC4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid
SMILESO=C(O)c1ccc(Cn2nnc3cc(Cl)c(Cl)cc32)cc1
InChIInChI=1S/C14H9Cl2N3O2/c15-10-5-12-13(6-11(10)16)19(18-17-12)7-8-1-3-9(4-2-8)14(20)21/h1-6H,7H2,(H,20,21)
InChIKeyQJDSFDHKXPGQSQ-UHFFFAOYSA-N
MW322.15 g/mol
LogP3.48
Rot. Bonds3

About 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid

4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid (PubChem CID 94750680) has the molecular formula C14H9Cl2N3O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid.

Molecular Properties

Compound Name4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid
PubChem CID94750680
Molecular FormulaC14H9Cl2N3O2
Molecular Weight322.15 g/mol
Exact Mass321.01
IUPAC Name4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid
SMILESO=C(O)c1ccc(Cn2nnc3cc(Cl)c(Cl)cc32)cc1
InChIInChI=1S/C14H9Cl2N3O2/c15-10-5-12-13(6-11(10)16)19(18-17-12)7-8-1-3-9(4-2-8)14(20)21/h1-6H,7H2,(H,20,21)
InChIKeyQJDSFDHKXPGQSQ-UHFFFAOYSA-N
XLogP3.48
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.15
LogP ≤ 53.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid?
The IUPAC name of 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid (CID 94750680) is 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid.
What is the SMILES notation for 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid?
The canonical SMILES for 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid is O=C(O)c1ccc(Cn2nnc3cc(Cl)c(Cl)cc32)cc1.
What is the InChIKey of 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid?
The InChIKey is QJDSFDHKXPGQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2N3O2/c15-10-5-12-13(6-11(10)16)19(18-17-12)7-8-1-3-9(4-2-8)14(20)21/h1-6H,7H2,(H,20,21).
What are the key properties of 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid?
4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid has a molecular weight of 322.15 g/mol, XLogP of 3.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,6-dichlorobenzotriazol-1-yl)methyl]benzoic acid is sourced from PubChem (CID 94750680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).