C8H7Cl2N3O — CID 82147134
2-(5,6-dichlorobenzotriazol-1-yl)ethanol (PubChem CID 82147134) has the molecular formula C8H7Cl2N3O and a molecular weight of 232.07 g/mol. Its IUPAC name is 2-(5,6-dichlorobenzotriazol-1-yl)ethanol.
| Compound Name | 2-(5,6-dichlorobenzotriazol-1-yl)ethanol |
|---|---|
| PubChem CID | 82147134 |
| Molecular Formula | C8H7Cl2N3O |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 2-(5,6-dichlorobenzotriazol-1-yl)ethanol |
| SMILES | OCCn1nnc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C8H7Cl2N3O/c9-5-3-7-8(4-6(5)10)13(1-2-14)12-11-7/h3-4,14H,1-2H2 |
| InChIKey | XJHBNIOKRVDHOJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |