C9H11N3S2 — CID 82146821
2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropan-1-amine (PubChem CID 82146821) has the molecular formula C9H11N3S2 and a molecular weight of 225.34 g/mol. Its IUPAC name is 2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropan-1-amine.
| Compound Name | 2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 82146821 |
| Molecular Formula | C9H11N3S2 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-thieno[2,3-d]pyrimidin-4-ylsulfanylpropan-1-amine |
| SMILES | CC(CN)Sc1ncnc2sccc12 |
| InChI | InChI=1S/C9H11N3S2/c1-6(4-10)14-9-7-2-3-13-8(7)11-5-12-9/h2-3,5-6H,4,10H2,1H3 |
| InChIKey | DGKGNMAUBSDMIQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |