C7H4N2O2S2 — CID 121352873
thieno[2,3-d]pyrimidin-4-ylsulfanylformic acid (PubChem CID 121352873) has the molecular formula C7H4N2O2S2 and a molecular weight of 212.25 g/mol. Its IUPAC name is thieno[2,3-d]pyrimidin-4-ylsulfanylformic acid.
| Compound Name | thieno[2,3-d]pyrimidin-4-ylsulfanylformic acid |
|---|---|
| PubChem CID | 121352873 |
| Molecular Formula | C7H4N2O2S2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | thieno[2,3-d]pyrimidin-4-ylsulfanylformic acid |
| SMILES | O=C(O)Sc1ncnc2sccc12 |
| InChI | InChI=1S/C7H4N2O2S2/c10-7(11)13-6-4-1-2-12-5(4)8-3-9-6/h1-3H,(H,10,11) |
| InChIKey | MYXGATMLKRZWIZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|