C15H14N4O2 — CID 82147424
4-(6,7-dihydro-[1,4]dioxino[2,3-f]benzotriazol-3-ylmethyl)aniline (PubChem CID 82147424) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-(6,7-dihydro-[1,4]dioxino[2,3-f]benzotriazol-3-ylmethyl)aniline.
| Compound Name | 4-(6,7-dihydro-[1,4]dioxino[2,3-f]benzotriazol-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 82147424 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-(6,7-dihydro-[1,4]dioxino[2,3-f]benzotriazol-3-ylmethyl)aniline |
| SMILES | Nc1ccc(Cn2nnc3cc4c(cc32)OCCO4)cc1 |
| InChI | InChI=1S/C15H14N4O2/c16-11-3-1-10(2-4-11)9-19-13-8-15-14(20-5-6-21-15)7-12(13)17-18-19/h1-4,7-8H,5-6,9,16H2 |
| InChIKey | IPQNLOFQJCVBRA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|