C11H13N3OS — CID 82147620
3-imidazo[1,2-a]pyridin-8-yloxy-2-methylpropanethioamide (PubChem CID 82147620) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-8-yloxy-2-methylpropanethioamide.
| Compound Name | 3-imidazo[1,2-a]pyridin-8-yloxy-2-methylpropanethioamide |
|---|---|
| PubChem CID | 82147620 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-8-yloxy-2-methylpropanethioamide |
| SMILES | CC(COc1cccn2ccnc12)C(N)=S |
| InChI | InChI=1S/C11H13N3OS/c1-8(10(12)16)7-15-9-3-2-5-14-6-4-13-11(9)14/h2-6,8H,7H2,1H3,(H2,12,16) |
| InChIKey | VVJGMPZIDDNANP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|