C14H21NO2 — CID 82152486
1-(3-amino-4-propan-2-yloxyphenyl)-2,2-dimethylpropan-1-one (PubChem CID 82152486) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-(3-amino-4-propan-2-yloxyphenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(3-amino-4-propan-2-yloxyphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 82152486 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-(3-amino-4-propan-2-yloxyphenyl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)Oc1ccc(C(=O)C(C)(C)C)cc1N |
| InChI | InChI=1S/C14H21NO2/c1-9(2)17-12-7-6-10(8-11(12)15)13(16)14(3,4)5/h6-9H,15H2,1-5H3 |
| InChIKey | JLLBCRUCLBDNHL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|