C18H23FN2O — CID 82153898
5-[3-(3-fluoroanilino)propyl]-2-propoxyaniline (PubChem CID 82153898) has the molecular formula C18H23FN2O and a molecular weight of 302.39 g/mol. Its IUPAC name is 5-[3-(3-fluoroanilino)propyl]-2-propoxyaniline.
| Compound Name | 5-[3-(3-fluoroanilino)propyl]-2-propoxyaniline |
|---|---|
| PubChem CID | 82153898 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 5-[3-(3-fluoroanilino)propyl]-2-propoxyaniline |
| SMILES | CCCOc1ccc(CCCNc2cccc(F)c2)cc1N |
| InChI | InChI=1S/C18H23FN2O/c1-2-11-22-18-9-8-14(12-17(18)20)5-4-10-21-16-7-3-6-15(19)13-16/h3,6-9,12-13,21H,2,4-5,10-11,20H2,1H3 |
| InChIKey | SYSOAGYNERSOPQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|