C17H20F2N2O — CID 94760420
N-[3-(3-amino-4-ethoxyphenyl)propyl]-2,6-difluoroaniline (PubChem CID 94760420) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is N-[3-(3-amino-4-ethoxyphenyl)propyl]-2,6-difluoroaniline.
| Compound Name | N-[3-(3-amino-4-ethoxyphenyl)propyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 94760420 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-[3-(3-amino-4-ethoxyphenyl)propyl]-2,6-difluoroaniline |
| SMILES | CCOc1ccc(CCCNc2c(F)cccc2F)cc1N |
| InChI | InChI=1S/C17H20F2N2O/c1-2-22-16-9-8-12(11-15(16)20)5-4-10-21-17-13(18)6-3-7-14(17)19/h3,6-9,11,21H,2,4-5,10,20H2,1H3 |
| InChIKey | STTLXBKILPGPHA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|