C21H30N2O — CID 82153944
5-[3-(4-tert-butylanilino)propyl]-2-ethoxyaniline (PubChem CID 82153944) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is 5-[3-(4-tert-butylanilino)propyl]-2-ethoxyaniline.
| Compound Name | 5-[3-(4-tert-butylanilino)propyl]-2-ethoxyaniline |
|---|---|
| PubChem CID | 82153944 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 5-[3-(4-tert-butylanilino)propyl]-2-ethoxyaniline |
| SMILES | CCOc1ccc(CCCNc2ccc(C(C)(C)C)cc2)cc1N |
| InChI | InChI=1S/C21H30N2O/c1-5-24-20-13-8-16(15-19(20)22)7-6-14-23-18-11-9-17(10-12-18)21(2,3)4/h8-13,15,23H,5-7,14,22H2,1-4H3 |
| InChIKey | ALNYBTGUUMGGFQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|