C19H26N2O — CID 82153932
N-[3-(3-amino-4-ethoxyphenyl)propyl]-2,3-dimethylaniline (PubChem CID 82153932) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[3-(3-amino-4-ethoxyphenyl)propyl]-2,3-dimethylaniline.
| Compound Name | N-[3-(3-amino-4-ethoxyphenyl)propyl]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 82153932 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-[3-(3-amino-4-ethoxyphenyl)propyl]-2,3-dimethylaniline |
| SMILES | CCOc1ccc(CCCNc2cccc(C)c2C)cc1N |
| InChI | InChI=1S/C19H26N2O/c1-4-22-19-11-10-16(13-17(19)20)8-6-12-21-18-9-5-7-14(2)15(18)3/h5,7,9-11,13,21H,4,6,8,12,20H2,1-3H3 |
| InChIKey | SDIHUEQKYBZLNC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|