C12H16N2O4 — CID 82159726
4-amino-5,7,8-trimethoxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82159726) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-amino-5,7,8-trimethoxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 4-amino-5,7,8-trimethoxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82159726 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 4-amino-5,7,8-trimethoxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1cc(OC)c2c(c1OC)NC(=O)CC2N |
| InChI | InChI=1S/C12H16N2O4/c1-16-7-5-8(17-2)12(18-3)11-10(7)6(13)4-9(15)14-11/h5-6H,4,13H2,1-3H3,(H,14,15) |
| InChIKey | XEQFVVWXQDKNIB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |