C12H15NO2 — CID 102319529
(4S)-8-methoxy-4,6-dimethyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 102319529) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (4S)-8-methoxy-4,6-dimethyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | (4S)-8-methoxy-4,6-dimethyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 102319529 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (4S)-8-methoxy-4,6-dimethyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1cc(C)cc2c1NC(=O)C[C@@H]2C |
| InChI | InChI=1S/C12H15NO2/c1-7-4-9-8(2)6-11(14)13-12(9)10(5-7)15-3/h4-5,8H,6H2,1-3H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | BVRIFCLQQLFNGC-QMMMGPOBSA-N |
| XLogP | 2.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |