C17H21N3O2S — CID 82162027
3-[4-methyl-2-(4-pyrrolidin-1-ylanilino)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 82162027) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 3-[4-methyl-2-(4-pyrrolidin-1-ylanilino)-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[4-methyl-2-(4-pyrrolidin-1-ylanilino)-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 82162027 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-[4-methyl-2-(4-pyrrolidin-1-ylanilino)-1,3-thiazol-5-yl]propanoic acid |
| SMILES | Cc1nc(Nc2ccc(N3CCCC3)cc2)sc1CCC(=O)O |
| InChI | InChI=1S/C17H21N3O2S/c1-12-15(8-9-16(21)22)23-17(18-12)19-13-4-6-14(7-5-13)20-10-2-3-11-20/h4-7H,2-3,8-11H2,1H3,(H,18,19)(H,21,22) |
| InChIKey | LCVXYRKBFGLWOP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|