C13H11F3N2O2S — CID 94777043
3-[4-methyl-2-(2,3,4-trifluoroanilino)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 94777043) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is 3-[4-methyl-2-(2,3,4-trifluoroanilino)-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[4-methyl-2-(2,3,4-trifluoroanilino)-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 94777043 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-[4-methyl-2-(2,3,4-trifluoroanilino)-1,3-thiazol-5-yl]propanoic acid |
| SMILES | Cc1nc(Nc2ccc(F)c(F)c2F)sc1CCC(=O)O |
| InChI | InChI=1S/C13H11F3N2O2S/c1-6-9(4-5-10(19)20)21-13(17-6)18-8-3-2-7(14)11(15)12(8)16/h2-3H,4-5H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | XUPISKNMBUFBLV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|