C17H23NO2 — CID 82163656
2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid (PubChem CID 82163656) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid.
| Compound Name | 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 82163656 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid |
| SMILES | CC(C)(C)CC(C)(C)n1cc2ccc(C(=O)O)cc2c1 |
| InChI | InChI=1S/C17H23NO2/c1-16(2,3)11-17(4,5)18-9-13-7-6-12(15(19)20)8-14(13)10-18/h6-10H,11H2,1-5H3,(H,19,20) |
| InChIKey | NIWPFISHIRUCBY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |