2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid

C17H23NO2 — CID 82163656

IUPAC2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid
SMILESCC(C)(C)CC(C)(C)n1cc2ccc(C(=O)O)cc2c1
InChIInChI=1S/C17H23NO2/c1-16(2,3)11-17(4,5)18-9-13-7-6-12(15(19)20)8-14(13)10-18/h6-10H,11H2,1-5H3,(H,19,20)
InChIKeyNIWPFISHIRUCBY-UHFFFAOYSA-N
MW273.38 g/mol
LogP4.51
Rot. Bonds3

About 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid

2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid (PubChem CID 82163656) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid.

Molecular Properties

Compound Name2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid
PubChem CID82163656
Molecular FormulaC17H23NO2
Molecular Weight273.38 g/mol
Exact Mass273.17
IUPAC Name2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid
SMILESCC(C)(C)CC(C)(C)n1cc2ccc(C(=O)O)cc2c1
InChIInChI=1S/C17H23NO2/c1-16(2,3)11-17(4,5)18-9-13-7-6-12(15(19)20)8-14(13)10-18/h6-10H,11H2,1-5H3,(H,19,20)
InChIKeyNIWPFISHIRUCBY-UHFFFAOYSA-N
XLogP4.51
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.38
LogP ≤ 54.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid?
The IUPAC name of 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid (CID 82163656) is 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid.
What is the SMILES notation for 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid?
The canonical SMILES for 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid is CC(C)(C)CC(C)(C)n1cc2ccc(C(=O)O)cc2c1.
What is the InChIKey of 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid?
The InChIKey is NIWPFISHIRUCBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO2/c1-16(2,3)11-17(4,5)18-9-13-7-6-12(15(19)20)8-14(13)10-18/h6-10H,11H2,1-5H3,(H,19,20).
What are the key properties of 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid?
2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid has a molecular weight of 273.38 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,4-trimethylpentan-2-yl)isoindole-5-carboxylic acid is sourced from PubChem (CID 82163656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).