C20H28N2 — CID 82163792
1-[2-(1-adamantyl)-1,3-dihydroisoindol-5-yl]-N-methylmethanamine (PubChem CID 82163792) has the molecular formula C20H28N2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-[2-(1-adamantyl)-1,3-dihydroisoindol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[2-(1-adamantyl)-1,3-dihydroisoindol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 82163792 |
| Molecular Formula | C20H28N2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-[2-(1-adamantyl)-1,3-dihydroisoindol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1ccc2c(c1)CN(C13CC4CC(CC(C4)C1)C3)C2 |
| InChI | InChI=1S/C20H28N2/c1-21-11-14-2-3-18-12-22(13-19(18)7-14)20-8-15-4-16(9-20)6-17(5-15)10-20/h2-3,7,15-17,21H,4-6,8-13H2,1H3 |
| InChIKey | SUGLFIBJQDXPKY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |