C25H34N2O — CID 22290722
(2E)-1-(1-adamantyl)-2-[3,3-dimethyl-7-(methylaminomethyl)-2,4-dihydroisoquinolin-1-ylidene]ethanone (PubChem CID 22290722) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is (2E)-1-(1-adamantyl)-2-[3,3-dimethyl-7-(methylaminomethyl)-2,4-dihydroisoquinolin-1-ylidene]ethanone.
| Compound Name | (2E)-1-(1-adamantyl)-2-[3,3-dimethyl-7-(methylaminomethyl)-2,4-dihydroisoquinolin-1-ylidene]ethanone |
|---|---|
| PubChem CID | 22290722 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (2E)-1-(1-adamantyl)-2-[3,3-dimethyl-7-(methylaminomethyl)-2,4-dihydroisoquinolin-1-ylidene]ethanone |
| SMILES | CNCc1ccc2c(c1)/C(=C\C(=O)C13CC4CC(CC(C4)C1)C3)NC(C)(C)C2 |
| InChI | InChI=1S/C25H34N2O/c1-24(2)14-20-5-4-16(15-26-3)9-21(20)22(27-24)10-23(28)25-11-17-6-18(12-25)8-19(7-17)13-25/h4-5,9-10,17-19,26-27H,6-8,11-15H2,1-3H3/b22-10+ |
| InChIKey | XWTHSGOZNSECOI-LSHDLFTRSA-N |
| XLogP | 4.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|