C24H32N2O — CID 22290843
(2E)-1-(1-adamantyl)-2-[7-(aminomethyl)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]ethanone (PubChem CID 22290843) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is (2E)-1-(1-adamantyl)-2-[7-(aminomethyl)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]ethanone.
| Compound Name | (2E)-1-(1-adamantyl)-2-[7-(aminomethyl)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]ethanone |
|---|---|
| PubChem CID | 22290843 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (2E)-1-(1-adamantyl)-2-[7-(aminomethyl)-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]ethanone |
| SMILES | CC1(C)Cc2ccc(CN)cc2/C(=C\C(=O)C23CC4CC(CC(C4)C2)C3)N1 |
| InChI | InChI=1S/C24H32N2O/c1-23(2)13-19-4-3-15(14-25)8-20(19)21(26-23)9-22(27)24-10-16-5-17(11-24)7-18(6-16)12-24/h3-4,8-9,16-18,26H,5-7,10-14,25H2,1-2H3/b21-9+ |
| InChIKey | MRZZZHUHOAPTGF-ZVBGSRNCSA-N |
| XLogP | 4.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|