C23H28BrNO — CID 22290565
(2E)-1-(1-adamantyl)-2-(6-bromo-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone (PubChem CID 22290565) has the molecular formula C23H28BrNO and a molecular weight of 414.39 g/mol. Its IUPAC name is (2E)-1-(1-adamantyl)-2-(6-bromo-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone.
| Compound Name | (2E)-1-(1-adamantyl)-2-(6-bromo-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone |
|---|---|
| PubChem CID | 22290565 |
| Molecular Formula | C23H28BrNO |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (2E)-1-(1-adamantyl)-2-(6-bromo-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone |
| SMILES | CC1(C)Cc2cc(Br)ccc2/C(=C\C(=O)C23CC4CC(CC(C4)C2)C3)N1 |
| InChI | InChI=1S/C23H28BrNO/c1-22(2)13-17-8-18(24)3-4-19(17)20(25-22)9-21(26)23-10-14-5-15(11-23)7-16(6-14)12-23/h3-4,8-9,14-16,25H,5-7,10-13H2,1-2H3/b20-9+ |
| InChIKey | NXTATVQCDLEOFD-AWQFTUOYSA-N |
| XLogP | 5.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|