C24H31NO2 — CID 22290800
(2E)-1-(1-adamantyl)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone (PubChem CID 22290800) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (2E)-1-(1-adamantyl)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone.
| Compound Name | (2E)-1-(1-adamantyl)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone |
|---|---|
| PubChem CID | 22290800 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (2E)-1-(1-adamantyl)-2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)ethanone |
| SMILES | COc1ccc2c(c1)/C(=C\C(=O)C13CC4CC(CC(C4)C1)C3)NC(C)(C)C2 |
| InChI | InChI=1S/C24H31NO2/c1-23(2)14-18-4-5-19(27-3)9-20(18)21(25-23)10-22(26)24-11-15-6-16(12-24)8-17(7-15)13-24/h4-5,9-10,15-17,25H,6-8,11-14H2,1-3H3/b21-10+ |
| InChIKey | SFZFAWXBGVMWMS-UFFVCSGVSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|