C26H36N2O — CID 69215501
1-(1-adamantyl)-2-[7-[(dimethylamino)methyl]-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]ethanone (PubChem CID 69215501) has the molecular formula C26H36N2O and a molecular weight of 392.59 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-[7-[(dimethylamino)methyl]-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]ethanone.
| Compound Name | 1-(1-adamantyl)-2-[7-[(dimethylamino)methyl]-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]ethanone |
|---|---|
| PubChem CID | 69215501 |
| Molecular Formula | C26H36N2O |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.28 |
| IUPAC Name | 1-(1-adamantyl)-2-[7-[(dimethylamino)methyl]-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene]ethanone |
| SMILES | CN(C)Cc1ccc2c(c1)C(=CC(=O)C13CC4CC(CC(C4)C1)C3)NC(C)(C)C2 |
| InChI | InChI=1S/C26H36N2O/c1-25(2)15-21-6-5-17(16-28(3)4)10-22(21)23(27-25)11-24(29)26-12-18-7-19(13-26)9-20(8-18)14-26/h5-6,10-11,18-20,27H,7-9,12-16H2,1-4H3 |
| InChIKey | DGEBOMUSIGKCSP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|