C25H34N2O2 — CID 22290838
(2E)-1-(1-adamantyl)-2-[6-methoxy-3,3-dimethyl-7-(methylamino)-2,4-dihydroisoquinolin-1-ylidene]ethanone (PubChem CID 22290838) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is (2E)-1-(1-adamantyl)-2-[6-methoxy-3,3-dimethyl-7-(methylamino)-2,4-dihydroisoquinolin-1-ylidene]ethanone.
| Compound Name | (2E)-1-(1-adamantyl)-2-[6-methoxy-3,3-dimethyl-7-(methylamino)-2,4-dihydroisoquinolin-1-ylidene]ethanone |
|---|---|
| PubChem CID | 22290838 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (2E)-1-(1-adamantyl)-2-[6-methoxy-3,3-dimethyl-7-(methylamino)-2,4-dihydroisoquinolin-1-ylidene]ethanone |
| SMILES | CNc1cc2c(cc1OC)CC(C)(C)N/C2=C/C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H34N2O2/c1-24(2)14-18-8-22(29-4)21(26-3)9-19(18)20(27-24)10-23(28)25-11-15-5-16(12-25)7-17(6-15)13-25/h8-10,15-17,26-27H,5-7,11-14H2,1-4H3/b20-10+ |
| InChIKey | MCDCKMSLRLUFMO-KEBDBYFISA-N |
| XLogP | 4.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|