C17H14N4S — CID 82166836
4-(6-methyl-5-phenyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)aniline (PubChem CID 82166836) has the molecular formula C17H14N4S and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-(6-methyl-5-phenyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)aniline.
| Compound Name | 4-(6-methyl-5-phenyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)aniline |
|---|---|
| PubChem CID | 82166836 |
| Molecular Formula | C17H14N4S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-(6-methyl-5-phenyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)aniline |
| SMILES | Cc1sc2nnc(-c3ccc(N)cc3)n2c1-c1ccccc1 |
| InChI | InChI=1S/C17H14N4S/c1-11-15(12-5-3-2-4-6-12)21-16(19-20-17(21)22-11)13-7-9-14(18)10-8-13/h2-10H,18H2,1H3 |
| InChIKey | NSVHSPBOVPSACQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|