C11H9N3S2 — CID 89466120
6-methyl-5-phenyl-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-3-thione (PubChem CID 89466120) has the molecular formula C11H9N3S2 and a molecular weight of 247.35 g/mol. Its IUPAC name is 6-methyl-5-phenyl-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-3-thione.
| Compound Name | 6-methyl-5-phenyl-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-3-thione |
|---|---|
| PubChem CID | 89466120 |
| Molecular Formula | C11H9N3S2 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 6-methyl-5-phenyl-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-3-thione |
| SMILES | Cc1sc2n[nH]c(=S)n2c1-c1ccccc1 |
| InChI | InChI=1S/C11H9N3S2/c1-7-9(8-5-3-2-4-6-8)14-10(15)12-13-11(14)16-7/h2-6H,1H3,(H,12,15) |
| InChIKey | WDIDORAOHOJYBV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|