C11H9N3S — CID 19837109
4-methyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione (PubChem CID 19837109) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 4-methyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione.
| Compound Name | 4-methyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione |
|---|---|
| PubChem CID | 19837109 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 4-methyl-2H-[1,2,4]triazolo[4,3-a]quinoline-1-thione |
| SMILES | Cc1cc2ccccc2n2c(=S)[nH]nc12 |
| InChI | InChI=1S/C11H9N3S/c1-7-6-8-4-2-3-5-9(8)14-10(7)12-13-11(14)15/h2-6H,1H3,(H,13,15) |
| InChIKey | QLLRNRNVIDUGEO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|