C9H15N3O — CID 82168026
3-(1-aminopropan-2-yl)-2,6-dimethylpyrimidin-4-one (PubChem CID 82168026) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-(1-aminopropan-2-yl)-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-(1-aminopropan-2-yl)-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 82168026 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-(1-aminopropan-2-yl)-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(C(C)CN)c(C)n1 |
| InChI | InChI=1S/C9H15N3O/c1-6-4-9(13)12(7(2)5-10)8(3)11-6/h4,7H,5,10H2,1-3H3 |
| InChIKey | PJMSXNRYDGHXEW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |