C16H20N4S — CID 82169394
4-piperazin-1-yl-2-thiophen-2-yl-5,6,7,8-tetrahydroquinazoline (PubChem CID 82169394) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 4-piperazin-1-yl-2-thiophen-2-yl-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 4-piperazin-1-yl-2-thiophen-2-yl-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 82169394 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-piperazin-1-yl-2-thiophen-2-yl-5,6,7,8-tetrahydroquinazoline |
| SMILES | c1csc(-c2nc3c(c(N4CCNCC4)n2)CCCC3)c1 |
| InChI | InChI=1S/C16H20N4S/c1-2-5-13-12(4-1)16(20-9-7-17-8-10-20)19-15(18-13)14-6-3-11-21-14/h3,6,11,17H,1-2,4-5,7-10H2 |
| InChIKey | RINCPGCTJXECNJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |