C13H15N5OS — CID 82176626
N-(5-piperidin-3-yl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 82176626) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is N-(5-piperidin-3-yl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | N-(5-piperidin-3-yl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 82176626 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(5-piperidin-3-yl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nnc(C2CCCNC2)s1)c1cccnc1 |
| InChI | InChI=1S/C13H15N5OS/c19-11(9-3-1-5-14-7-9)16-13-18-17-12(20-13)10-4-2-6-15-8-10/h1,3,5,7,10,15H,2,4,6,8H2,(H,16,18,19) |
| InChIKey | AGRGJMASUHKOIP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |