C11H10N2O3 — CID 82179055
2-[[2-(cyanomethyl)benzoyl]amino]acetic acid (PubChem CID 82179055) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-[[2-(cyanomethyl)benzoyl]amino]acetic acid.
| Compound Name | 2-[[2-(cyanomethyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 82179055 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-[[2-(cyanomethyl)benzoyl]amino]acetic acid |
| SMILES | N#CCc1ccccc1C(=O)NCC(=O)O |
| InChI | InChI=1S/C11H10N2O3/c12-6-5-8-3-1-2-4-9(8)11(16)13-7-10(14)15/h1-4H,5,7H2,(H,13,16)(H,14,15) |
| InChIKey | WFMZBIQLDLYVDI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |