C9H8INO4 — CID 163099748
2-[(2-hydroxy-3-iodobenzoyl)amino]acetic acid (PubChem CID 163099748) has the molecular formula C9H8INO4 and a molecular weight of 321.07 g/mol. Its IUPAC name is 2-[(2-hydroxy-3-iodobenzoyl)amino]acetic acid.
| Compound Name | 2-[(2-hydroxy-3-iodobenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 163099748 |
| Molecular Formula | C9H8INO4 |
| Molecular Weight | 321.07 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | 2-[(2-hydroxy-3-iodobenzoyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cccc(I)c1O |
| InChI | InChI=1S/C9H8INO4/c10-6-3-1-2-5(8(6)14)9(15)11-4-7(12)13/h1-3,14H,4H2,(H,11,15)(H,12,13) |
| InChIKey | KHQLHBZVYVBLNM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.07 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|