C15H10F2INO4 — CID 11419087
2-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]acetic acid (PubChem CID 11419087) has the molecular formula C15H10F2INO4 and a molecular weight of 433.15 g/mol. Its IUPAC name is 2-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]acetic acid.
| Compound Name | 2-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 11419087 |
| Molecular Formula | C15H10F2INO4 |
| Molecular Weight | 433.15 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | 2-[[5-(2,4-difluorophenyl)-2-hydroxy-3-iodobenzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cc(-c2ccc(F)cc2F)cc(I)c1O |
| InChI | InChI=1S/C15H10F2INO4/c16-8-1-2-9(11(17)5-8)7-3-10(14(22)12(18)4-7)15(23)19-6-13(20)21/h1-5,22H,6H2,(H,19,23)(H,20,21) |
| InChIKey | SOLHJARPNVFITK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|