C18H21NO4 — CID 82183541
3-[1-[3-(1-benzofuran-2-yl)-3-oxopropyl]pyrrolidin-2-yl]propanoic acid (PubChem CID 82183541) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[1-[3-(1-benzofuran-2-yl)-3-oxopropyl]pyrrolidin-2-yl]propanoic acid.
| Compound Name | 3-[1-[3-(1-benzofuran-2-yl)-3-oxopropyl]pyrrolidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 82183541 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-[1-[3-(1-benzofuran-2-yl)-3-oxopropyl]pyrrolidin-2-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCCN1CCC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H21NO4/c20-15(17-12-13-4-1-2-6-16(13)23-17)9-11-19-10-3-5-14(19)7-8-18(21)22/h1-2,4,6,12,14H,3,5,7-11H2,(H,21,22) |
| InChIKey | WPWOQKIPTHUJAE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |