C19H23NO4 — CID 82183542
3-[1-[3-(3-methyl-1-benzofuran-2-yl)-3-oxopropyl]pyrrolidin-2-yl]propanoic acid (PubChem CID 82183542) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[1-[3-(3-methyl-1-benzofuran-2-yl)-3-oxopropyl]pyrrolidin-2-yl]propanoic acid.
| Compound Name | 3-[1-[3-(3-methyl-1-benzofuran-2-yl)-3-oxopropyl]pyrrolidin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 82183542 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-[1-[3-(3-methyl-1-benzofuran-2-yl)-3-oxopropyl]pyrrolidin-2-yl]propanoic acid |
| SMILES | Cc1c(C(=O)CCN2CCCC2CCC(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C19H23NO4/c1-13-15-6-2-3-7-17(15)24-19(13)16(21)10-12-20-11-4-5-14(20)8-9-18(22)23/h2-3,6-7,14H,4-5,8-12H2,1H3,(H,22,23) |
| InChIKey | MFRQYEYUJRCAKN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |