C8H7BrN2S — CID 82184450
5-bromo-6-methyl-1,3-dihydrobenzimidazole-2-thione (PubChem CID 82184450) has the molecular formula C8H7BrN2S and a molecular weight of 243.13 g/mol. Its IUPAC name is 5-bromo-6-methyl-1,3-dihydrobenzimidazole-2-thione.
| Compound Name | 5-bromo-6-methyl-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| PubChem CID | 82184450 |
| Molecular Formula | C8H7BrN2S |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 241.95 |
| IUPAC Name | 5-bromo-6-methyl-1,3-dihydrobenzimidazole-2-thione |
| SMILES | Cc1cc2[nH]c(=S)[nH]c2cc1Br |
| InChI | InChI=1S/C8H7BrN2S/c1-4-2-6-7(3-5(4)9)11-8(12)10-6/h2-3H,1H3,(H2,10,11,12) |
| InChIKey | PBAUBVHXZKGSHO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|