C18H19N3OS — CID 82186093
5-[(4-propoxyphenyl)methyl]-4-pyridin-2-yl-1,3-thiazol-2-amine (PubChem CID 82186093) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 5-[(4-propoxyphenyl)methyl]-4-pyridin-2-yl-1,3-thiazol-2-amine.
| Compound Name | 5-[(4-propoxyphenyl)methyl]-4-pyridin-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82186093 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-[(4-propoxyphenyl)methyl]-4-pyridin-2-yl-1,3-thiazol-2-amine |
| SMILES | CCCOc1ccc(Cc2sc(N)nc2-c2ccccn2)cc1 |
| InChI | InChI=1S/C18H19N3OS/c1-2-11-22-14-8-6-13(7-9-14)12-16-17(21-18(19)23-16)15-5-3-4-10-20-15/h3-10H,2,11-12H2,1H3,(H2,19,21) |
| InChIKey | VZOFDLMDNUYLPO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |